C34H33F2N3O4S — CID 171076627
2-[7-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-7-(3-methylphenyl)heptyl]sulfanylacetic acid (PubChem CID 171076627) has the molecular formula C34H33F2N3O4S and a molecular weight of 617.72 g/mol. Its IUPAC name is 2-[7-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-7-(3-methylphenyl)heptyl]sulfanylacetic acid.
| Compound Name | 2-[7-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-7-(3-methylphenyl)heptyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 171076627 |
| Molecular Formula | C34H33F2N3O4S |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | 2-[7-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-7-(3-methylphenyl)heptyl]sulfanylacetic acid |
| SMILES | Cc1cccc(C(CCCCCCSCC(=O)O)c2cnc(-c3cc(Oc4c(F)cc5[nH]ccc5c4C=O)ccc3F)[nH]2)c1 |
| InChI | InChI=1S/C34H33F2N3O4S/c1-21-7-6-8-22(15-21)24(9-4-2-3-5-14-44-20-32(41)42)31-18-38-34(39-31)26-16-23(10-11-28(26)35)43-33-27(19-40)25-12-13-37-30(25)17-29(33)36/h6-8,10-13,15-19,24,37H,2-5,9,14,20H2,1H3,(H,38,39)(H,41,42) |
| InChIKey | JZDJZRKUBFJRNN-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|