C34H32F2N4O2 — CID 171078516
8-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-8-(3-methylphenyl)nonanenitrile (PubChem CID 171078516) has the molecular formula C34H32F2N4O2 and a molecular weight of 566.65 g/mol. Its IUPAC name is 8-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-8-(3-methylphenyl)nonanenitrile.
| Compound Name | 8-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-8-(3-methylphenyl)nonanenitrile |
|---|---|
| PubChem CID | 171078516 |
| Molecular Formula | C34H32F2N4O2 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 8-[2-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]-1H-imidazol-5-yl]-8-(3-methylphenyl)nonanenitrile |
| SMILES | Cc1cccc(C(C)(CCCCCCC#N)c2cnc(-c3cc(Oc4c(F)cc5[nH]ccc5c4C=O)ccc3F)[nH]2)c1 |
| InChI | InChI=1S/C34H32F2N4O2/c1-22-9-8-10-23(17-22)34(2,14-6-4-3-5-7-15-37)31-20-39-33(40-31)26-18-24(11-12-28(26)35)42-32-27(21-41)25-13-16-38-30(25)19-29(32)36/h8-13,16-21,38H,3-7,14H2,1-2H3,(H,39,40) |
| InChIKey | ZNJJAHAYJBMMRC-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|