C24H37NO4+2 — CID 171078141
[2-but-1-en-2-yl-6-carboxy-6-[4-(2-ethoxy-2-oxoethyl)phenyl]-2-methylheptyl]-methylazanium (PubChem CID 171078141) has the molecular formula C24H37NO4+2 and a molecular weight of 403.56 g/mol. Its IUPAC name is [2-but-1-en-2-yl-6-carboxy-6-[4-(2-ethoxy-2-oxoethyl)phenyl]-2-methylheptyl]-methylazanium.
| Compound Name | [2-but-1-en-2-yl-6-carboxy-6-[4-(2-ethoxy-2-oxoethyl)phenyl]-2-methylheptyl]-methylazanium |
|---|---|
| PubChem CID | 171078141 |
| Molecular Formula | C24H37NO4+2 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | [2-but-1-en-2-yl-6-carboxy-6-[4-(2-ethoxy-2-oxoethyl)phenyl]-2-methylheptyl]-methylazanium |
| SMILES | [H]/[C+]=C(\CC)C(C)(CCCC(C)(C(=O)O)c1ccc(CC(=O)OCC)cc1)C[NH2+]C |
| InChI | InChI=1S/C24H35NO4/c1-7-18(3)23(4,17-25-6)14-9-15-24(5,22(27)28)20-12-10-19(11-13-20)16-21(26)29-8-2/h3,10-13,25H,7-9,14-17H2,1-2,4-6H3/p+2 |
| InChIKey | YTKNFNSPBCQQIB-UHFFFAOYSA-P |
| XLogP | 3.27 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|