C33H30F2IN3O4S — CID 171078769
ethyl 3-[3-[1-[3-[2-fluoro-5-[6-fluoro-4-(hydroxymethyl)-1-iodosulfanylindol-5-yl]oxyphenyl]pyrazol-1-yl]but-3-enyl]phenyl]propanoate (PubChem CID 171078769) has the molecular formula C33H30F2IN3O4S and a molecular weight of 729.59 g/mol. Its IUPAC name is ethyl 3-[3-[1-[3-[2-fluoro-5-[6-fluoro-4-(hydroxymethyl)-1-iodosulfanylindol-5-yl]oxyphenyl]pyrazol-1-yl]but-3-enyl]phenyl]propanoate.
| Compound Name | ethyl 3-[3-[1-[3-[2-fluoro-5-[6-fluoro-4-(hydroxymethyl)-1-iodosulfanylindol-5-yl]oxyphenyl]pyrazol-1-yl]but-3-enyl]phenyl]propanoate |
|---|---|
| PubChem CID | 171078769 |
| Molecular Formula | C33H30F2IN3O4S |
| Molecular Weight | 729.59 g/mol |
| Exact Mass | 729.10 |
| IUPAC Name | ethyl 3-[3-[1-[3-[2-fluoro-5-[6-fluoro-4-(hydroxymethyl)-1-iodosulfanylindol-5-yl]oxyphenyl]pyrazol-1-yl]but-3-enyl]phenyl]propanoate |
| SMILES | C=CCC(c1cccc(CCC(=O)OCC)c1)n1ccc(-c2cc(Oc3c(F)cc4c(ccn4SI)c3CO)ccc2F)n1 |
| InChI | InChI=1S/C33H30F2IN3O4S/c1-3-6-30(22-8-5-7-21(17-22)9-12-32(41)42-4-2)38-15-14-29(37-38)25-18-23(10-11-27(25)34)43-33-26(20-40)24-13-16-39(44-36)31(24)19-28(33)35/h3,5,7-8,10-11,13-19,30,40H,1,4,6,9,12,20H2,2H3 |
| InChIKey | VKTJGZAPJJHGKX-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.59 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|