C34H31BrF2IN3O4S — CID 171078541
methyl 6-(3-bromophenyl)-6-[3-[2-fluoro-5-[6-fluoro-1-iodosulfanyl-4-(2-oxoethyl)indol-5-yl]oxyphenyl]pyrazol-1-yl]-2,2-dimethylhexanoate (PubChem CID 171078541) has the molecular formula C34H31BrF2IN3O4S and a molecular weight of 822.51 g/mol. Its IUPAC name is methyl 6-(3-bromophenyl)-6-[3-[2-fluoro-5-[6-fluoro-1-iodosulfanyl-4-(2-oxoethyl)indol-5-yl]oxyphenyl]pyrazol-1-yl]-2,2-dimethylhexanoate.
| Compound Name | methyl 6-(3-bromophenyl)-6-[3-[2-fluoro-5-[6-fluoro-1-iodosulfanyl-4-(2-oxoethyl)indol-5-yl]oxyphenyl]pyrazol-1-yl]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 171078541 |
| Molecular Formula | C34H31BrF2IN3O4S |
| Molecular Weight | 822.51 g/mol |
| Exact Mass | 821.02 |
| IUPAC Name | methyl 6-(3-bromophenyl)-6-[3-[2-fluoro-5-[6-fluoro-1-iodosulfanyl-4-(2-oxoethyl)indol-5-yl]oxyphenyl]pyrazol-1-yl]-2,2-dimethylhexanoate |
| SMILES | COC(=O)C(C)(C)CCCC(c1cccc(Br)c1)n1ccc(-c2cc(Oc3c(F)cc4c(ccn4SI)c3CC=O)ccc2F)n1 |
| InChI | InChI=1S/C34H31BrF2IN3O4S/c1-34(2,33(43)44-3)14-5-8-30(21-6-4-7-22(35)18-21)40-15-12-29(39-40)26-19-23(9-10-27(26)36)45-32-25(13-17-42)24-11-16-41(46-38)31(24)20-28(32)37/h4,6-7,9-12,15-20,30H,5,8,13-14H2,1-3H3 |
| InChIKey | CFILBFVMYXWNKS-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.51 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|