C33H30BrF2N3O5 — CID 171078352
methyl 4-[2-(3-bromophenyl)-2-[3-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]pyrazol-1-yl]ethoxy]-2,2-dimethylbutanoate (PubChem CID 171078352) has the molecular formula C33H30BrF2N3O5 and a molecular weight of 666.52 g/mol. Its IUPAC name is methyl 4-[2-(3-bromophenyl)-2-[3-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]pyrazol-1-yl]ethoxy]-2,2-dimethylbutanoate.
| Compound Name | methyl 4-[2-(3-bromophenyl)-2-[3-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]pyrazol-1-yl]ethoxy]-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 171078352 |
| Molecular Formula | C33H30BrF2N3O5 |
| Molecular Weight | 666.52 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | methyl 4-[2-(3-bromophenyl)-2-[3-[2-fluoro-5-[(6-fluoro-4-formyl-1H-indol-5-yl)oxy]phenyl]pyrazol-1-yl]ethoxy]-2,2-dimethylbutanoate |
| SMILES | COC(=O)C(C)(C)CCOCC(c1cccc(Br)c1)n1ccc(-c2cc(Oc3c(F)cc4[nH]ccc4c3C=O)ccc2F)n1 |
| InChI | InChI=1S/C33H30BrF2N3O5/c1-33(2,32(41)42-3)11-14-43-19-30(20-5-4-6-21(34)15-20)39-13-10-28(38-39)24-16-22(7-8-26(24)35)44-31-25(18-40)23-9-12-37-29(23)17-27(31)36/h4-10,12-13,15-18,30,37H,11,14,19H2,1-3H3 |
| InChIKey | CXBBCJIALXEUQF-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.52 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|