C17H11BrF2INO2S — CID 171076657
[4-bromo-6-fluoro-5-(4-fluoro-3-propanoylphenoxy)indol-1-yl] thiohypoiodite (PubChem CID 171076657) has the molecular formula C17H11BrF2INO2S and a molecular weight of 538.15 g/mol. Its IUPAC name is [4-bromo-6-fluoro-5-(4-fluoro-3-propanoylphenoxy)indol-1-yl] thiohypoiodite.
| Compound Name | [4-bromo-6-fluoro-5-(4-fluoro-3-propanoylphenoxy)indol-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 171076657 |
| Molecular Formula | C17H11BrF2INO2S |
| Molecular Weight | 538.15 g/mol |
| Exact Mass | 536.87 |
| IUPAC Name | [4-bromo-6-fluoro-5-(4-fluoro-3-propanoylphenoxy)indol-1-yl] thiohypoiodite |
| SMILES | CCC(=O)c1cc(Oc2c(F)cc3c(ccn3SI)c2Br)ccc1F |
| InChI | InChI=1S/C17H11BrF2INO2S/c1-2-15(23)11-7-9(3-4-12(11)19)24-17-13(20)8-14-10(16(17)18)5-6-22(14)25-21/h3-8H,2H2,1H3 |
| InChIKey | CGDXXDJKQOEWFI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.15 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|