C28H24F2N2O5S — CID 176798944
methyl 3-[6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1-(4-methylphenyl)sulfonylindol-4-yl]-2,2-dimethylpropanoate (PubChem CID 176798944) has the molecular formula C28H24F2N2O5S and a molecular weight of 538.57 g/mol. Its IUPAC name is methyl 3-[6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1-(4-methylphenyl)sulfonylindol-4-yl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1-(4-methylphenyl)sulfonylindol-4-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176798944 |
| Molecular Formula | C28H24F2N2O5S |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | methyl 3-[6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1-(4-methylphenyl)sulfonylindol-4-yl]-2,2-dimethylpropanoate |
| SMILES | [C-]#[N+]c1cc(Oc2c(F)cc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c2CC(C)(C)C(=O)OC)ccc1F |
| InChI | InChI=1S/C28H24F2N2O5S/c1-17-6-9-19(10-7-17)38(34,35)32-13-12-20-21(16-28(2,3)27(33)36-5)26(23(30)15-25(20)32)37-18-8-11-22(29)24(14-18)31-4/h6-15H,16H2,1-3,5H3 |
| InChIKey | ZKWJJVLOLHHPSE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 78.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|