C29H26F2N2O4S — CID 171079209
(E)-3-(dimethylamino)-1-[2-fluoro-5-[6-fluoro-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindol-5-yl]oxyphenyl]prop-2-en-1-one (PubChem CID 171079209) has the molecular formula C29H26F2N2O4S and a molecular weight of 536.60 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-1-[2-fluoro-5-[6-fluoro-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindol-5-yl]oxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(dimethylamino)-1-[2-fluoro-5-[6-fluoro-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindol-5-yl]oxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171079209 |
| Molecular Formula | C29H26F2N2O4S |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | (E)-3-(dimethylamino)-1-[2-fluoro-5-[6-fluoro-1-(4-methylphenyl)sulfonyl-4-prop-2-enylindol-5-yl]oxyphenyl]prop-2-en-1-one |
| SMILES | C=CCc1c(Oc2ccc(F)c(C(=O)/C=C/N(C)C)c2)c(F)cc2c1ccn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H26F2N2O4S/c1-5-6-23-22-13-16-33(38(35,36)21-10-7-19(2)8-11-21)27(22)18-26(31)29(23)37-20-9-12-25(30)24(17-20)28(34)14-15-32(3)4/h5,7-18H,1,6H2,2-4H3/b15-14+ |
| InChIKey | UASVEZUIHZRKJR-CCEZHUSRSA-N |
| XLogP | 6.24 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|