C23H17FN2O3S2 — CID 171771317
6-fluoro-5-(3-isocyanophenoxy)-1-(4-methylphenyl)sulfonyl-4-methylsulfanylindole (PubChem CID 171771317) has the molecular formula C23H17FN2O3S2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 6-fluoro-5-(3-isocyanophenoxy)-1-(4-methylphenyl)sulfonyl-4-methylsulfanylindole.
| Compound Name | 6-fluoro-5-(3-isocyanophenoxy)-1-(4-methylphenyl)sulfonyl-4-methylsulfanylindole |
|---|---|
| PubChem CID | 171771317 |
| Molecular Formula | C23H17FN2O3S2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 6-fluoro-5-(3-isocyanophenoxy)-1-(4-methylphenyl)sulfonyl-4-methylsulfanylindole |
| SMILES | [C-]#[N+]c1cccc(Oc2c(F)cc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c2SC)c1 |
| InChI | InChI=1S/C23H17FN2O3S2/c1-15-7-9-18(10-8-15)31(27,28)26-12-11-19-21(26)14-20(24)22(23(19)30-3)29-17-6-4-5-16(13-17)25-2/h4-14H,1,3H3 |
| InChIKey | KEIVZAXVXIKRBL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|