C6H10FNO — CID 171080186
(3R,4S)-3-fluoropiperidine-4-carbaldehyde (PubChem CID 171080186) has the molecular formula C6H10FNO and a molecular weight of 131.15 g/mol. Its IUPAC name is (3R,4S)-3-fluoropiperidine-4-carbaldehyde.
| Compound Name | (3R,4S)-3-fluoropiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 171080186 |
| Molecular Formula | C6H10FNO |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (3R,4S)-3-fluoropiperidine-4-carbaldehyde |
| SMILES | O=C[C@@H]1CCNC[C@@H]1F |
| InChI | InChI=1S/C6H10FNO/c7-6-3-8-2-1-5(6)4-9/h4-6,8H,1-3H2/t5-,6-/m0/s1 |
| InChIKey | OIOCGVUOKKWNDX-WDSKDSINSA-N |
| XLogP | 0.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|