C15H38N4S3 — CID 171080543
1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol (PubChem CID 171080543) has the molecular formula C15H38N4S3 and a molecular weight of 370.70 g/mol. Its IUPAC name is 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol.
| Compound Name | 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol |
|---|---|
| PubChem CID | 171080543 |
| Molecular Formula | C15H38N4S3 |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol |
| SMILES | CCCN(CCSCCN)C(C)CNCCSCCN.CS |
| InChI | InChI=1S/C14H34N4S2.CH4S/c1-3-7-18(8-12-20-10-5-16)14(2)13-17-6-11-19-9-4-15;1-2/h14,17H,3-13,15-16H2,1-2H3;2H,1H3 |
| InChIKey | MLUCKZVFAOLLQN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|