About 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol
1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol (PubChem CID 171080543) has the molecular formula C15H38N4S3
and a molecular weight of 370.70 g/mol. Its IUPAC name is 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol.
Molecular Properties
| Compound Name | 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol |
| PubChem CID | 171080543 |
| Molecular Formula | C15H38N4S3 |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol |
| SMILES | CCCN(CCSCCN)C(C)CNCCSCCN.CS |
| InChI | InChI=1S/C14H34N4S2.CH4S/c1-3-7-18(8-12-20-10-5-16)14(2)13-17-6-11-19-9-4-15;1-2/h14,17H,3-13,15-16H2,1-2H3;2H,1H3 |
| InChIKey | MLUCKZVFAOLLQN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol?
The IUPAC name of 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol (CID 171080543) is 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol.
What is the SMILES notation for 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol?
The canonical SMILES for 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol is CCCN(CCSCCN)C(C)CNCCSCCN.CS.
What is the InChIKey of 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol?
The InChIKey is MLUCKZVFAOLLQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H34N4S2.CH4S/c1-3-7-18(8-12-20-10-5-16)14(2)13-17-6-11-19-9-4-15;1-2/h14,17H,3-13,15-16H2,1-2H3;2H,1H3.
What are the key properties of 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol?
1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol has a molecular weight of 370.70 g/mol, XLogP of 1.61, 15 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-bis[2-(2-aminoethylsulfanyl)ethyl]-2-N-propylpropane-1,2-diamine;methanethiol is sourced from PubChem (CID 171080543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).