C18H17N7O — CID 171084299
2-[[4-[5-(dimethylamino)-3-pyridinyl]triazol-1-yl]methyl]imidazo[1,2-a]pyridine-6-carbaldehyde (PubChem CID 171084299) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-[[4-[5-(dimethylamino)-3-pyridinyl]triazol-1-yl]methyl]imidazo[1,2-a]pyridine-6-carbaldehyde.
| Compound Name | 2-[[4-[5-(dimethylamino)-3-pyridinyl]triazol-1-yl]methyl]imidazo[1,2-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 171084299 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[[4-[5-(dimethylamino)-3-pyridinyl]triazol-1-yl]methyl]imidazo[1,2-a]pyridine-6-carbaldehyde |
| SMILES | CN(C)c1cncc(-c2cn(Cc3cn4cc(C=O)ccc4n3)nn2)c1 |
| InChI | InChI=1S/C18H17N7O/c1-23(2)16-5-14(6-19-7-16)17-11-25(22-21-17)10-15-9-24-8-13(12-26)3-4-18(24)20-15/h3-9,11-12H,10H2,1-2H3 |
| InChIKey | KXHCSYIKGRNOHL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|