C24H26N9Si — CID 174070100
CID 174070100 (PubChem CID 174070100) has the molecular formula C24H26N9Si and a molecular weight of 468.62 g/mol.
| Compound Name | CID 174070100 |
|---|---|
| PubChem CID | 174070100 |
| Molecular Formula | C24H26N9Si |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | — |
| SMILES | C[Si]1CN(Cc2ccc3nc(Cn4cc(-c5cncc(-n6cccc6)c5)nn4)cn3c2)CCN1 |
| InChI | InChI=1S/C24H26N9Si/c1-34-18-30(9-6-26-34)13-19-4-5-24-27-21(15-32(24)14-19)16-33-17-23(28-29-33)20-10-22(12-25-11-20)31-7-2-3-8-31/h2-5,7-8,10-12,14-15,17,26H,6,9,13,16,18H2,1H3 |
| InChIKey | ZDZNBTOEACDJLX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|