C30H47N3O4Si — CID 171086056
N-[(1R)-1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-methoxyphenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide (PubChem CID 171086056) has the molecular formula C30H47N3O4Si and a molecular weight of 541.81 g/mol. Its IUPAC name is N-[(1R)-1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-methoxyphenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[(1R)-1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-methoxyphenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 171086056 |
| Molecular Formula | C30H47N3O4Si |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | N-[(1R)-1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-methoxyphenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide |
| SMILES | COc1cc([C@@H](C)NC(=O)c2cc(N3CCN(C)CC3)ccc2C)ccc1OCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H47N3O4Si/c1-22-10-12-25(33-16-14-32(6)15-17-33)21-26(22)29(34)31-23(2)24-11-13-27(28(20-24)35-7)36-18-19-37-38(8,9)30(3,4)5/h10-13,20-21,23H,14-19H2,1-9H3,(H,31,34)/t23-/m1/s1 |
| InChIKey | QPPQCHJIVSQDLR-HSZRJFAPSA-N |
| XLogP | 5.65 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|