C28H41N5O3 — CID 171086459
N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-4-(2-hydroxyethoxy)phenyl]ethyl]-5-[2-(butylamino)ethylamino]-2-methylbenzamide (PubChem CID 171086459) has the molecular formula C28H41N5O3 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-4-(2-hydroxyethoxy)phenyl]ethyl]-5-[2-(butylamino)ethylamino]-2-methylbenzamide.
| Compound Name | N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-4-(2-hydroxyethoxy)phenyl]ethyl]-5-[2-(butylamino)ethylamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 171086459 |
| Molecular Formula | C28H41N5O3 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-4-(2-hydroxyethoxy)phenyl]ethyl]-5-[2-(butylamino)ethylamino]-2-methylbenzamide |
| SMILES | CCCCNCCNc1ccc(C)c(C(=O)NC(C)c2ccc(OCCO)c(C(=C/N)/C=N/C)c2)c1 |
| InChI | InChI=1S/C28H41N5O3/c1-5-6-11-31-12-13-32-24-9-7-20(2)25(17-24)28(35)33-21(3)22-8-10-27(36-15-14-34)26(16-22)23(18-29)19-30-4/h7-10,16-19,21,31-32,34H,5-6,11-15,29H2,1-4H3,(H,33,35)/b23-18+,30-19+ |
| InChIKey | YEEQZLCIRLMXFY-KSWGNFLVSA-N |
| XLogP | 3.66 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|