C24H32N4O2 — CID 171086472
N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methoxyphenyl]ethyl]-2-methyl-5-(propylamino)benzamide (PubChem CID 171086472) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methoxyphenyl]ethyl]-2-methyl-5-(propylamino)benzamide.
| Compound Name | N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methoxyphenyl]ethyl]-2-methyl-5-(propylamino)benzamide |
|---|---|
| PubChem CID | 171086472 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N-[1-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-methoxyphenyl]ethyl]-2-methyl-5-(propylamino)benzamide |
| SMILES | CCCNc1ccc(C)c(C(=O)NC(C)c2cc(OC)cc(C(=C/N)/C=N/C)c2)c1 |
| InChI | InChI=1S/C24H32N4O2/c1-6-9-27-21-8-7-16(2)23(13-21)24(29)28-17(3)18-10-19(12-22(11-18)30-5)20(14-25)15-26-4/h7-8,10-15,17,27H,6,9,25H2,1-5H3,(H,28,29)/b20-14+,26-15+ |
| InChIKey | BZNXPEVLKNGYQE-GDGRXUHXSA-N |
| XLogP | 4.32 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|