C16H24N2O — CID 171086952
3-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-1,1-dimethylurea (PubChem CID 171086952) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-1,1-dimethylurea.
| Compound Name | 3-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 171086952 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-1,1-dimethylurea |
| SMILES | CCc1cc2c(c(NC(=O)N(C)C)c1CC)CCC2 |
| InChI | InChI=1S/C16H24N2O/c1-5-11-10-12-8-7-9-14(12)15(13(11)6-2)17-16(19)18(3)4/h10H,5-9H2,1-4H3,(H,17,19) |
| InChIKey | HXCZNENSSVGOPG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |