C21H27N3O3S — CID 145352517
1-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-3-[methyl(phenyl)sulfamoyl]urea (PubChem CID 145352517) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-3-[methyl(phenyl)sulfamoyl]urea.
| Compound Name | 1-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-3-[methyl(phenyl)sulfamoyl]urea |
|---|---|
| PubChem CID | 145352517 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-(5,6-diethyl-2,3-dihydro-1H-inden-4-yl)-3-[methyl(phenyl)sulfamoyl]urea |
| SMILES | CCc1cc2c(c(NC(=O)NS(=O)(=O)N(C)c3ccccc3)c1CC)CCC2 |
| InChI | InChI=1S/C21H27N3O3S/c1-4-15-14-16-10-9-13-19(16)20(18(15)5-2)22-21(25)23-28(26,27)24(3)17-11-7-6-8-12-17/h6-8,11-12,14H,4-5,9-10,13H2,1-3H3,(H2,22,23,25) |
| InChIKey | INOPHELPQMTYNG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |