C25H25FN6O3S — CID 171088827
N-[7-[(E)-1-amino-2-methoxy-3-methyliminoprop-1-enyl]-5-[1-(oxetan-3-yl)ethoxy]quinazolin-4-yl]-7-fluoro-1,3-benzothiazol-6-amine (PubChem CID 171088827) has the molecular formula C25H25FN6O3S and a molecular weight of 508.58 g/mol. Its IUPAC name is N-[7-[(E)-1-amino-2-methoxy-3-methyliminoprop-1-enyl]-5-[1-(oxetan-3-yl)ethoxy]quinazolin-4-yl]-7-fluoro-1,3-benzothiazol-6-amine.
| Compound Name | N-[7-[(E)-1-amino-2-methoxy-3-methyliminoprop-1-enyl]-5-[1-(oxetan-3-yl)ethoxy]quinazolin-4-yl]-7-fluoro-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 171088827 |
| Molecular Formula | C25H25FN6O3S |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[7-[(E)-1-amino-2-methoxy-3-methyliminoprop-1-enyl]-5-[1-(oxetan-3-yl)ethoxy]quinazolin-4-yl]-7-fluoro-1,3-benzothiazol-6-amine |
| SMILES | C/N=C/C(OC)=C(\N)c1cc(OC(C)C2COC2)c2c(Nc3ccc4ncsc4c3F)ncnc2c1 |
| InChI | InChI=1S/C25H25FN6O3S/c1-13(15-9-34-10-15)35-19-7-14(23(27)20(33-3)8-28-2)6-18-21(19)25(30-11-29-18)32-16-4-5-17-24(22(16)26)36-12-31-17/h4-8,11-13,15H,9-10,27H2,1-3H3,(H,29,30,32)/b23-20+,28-8+ |
| InChIKey | DBLFQDNUNOHACS-ZXFAULSPSA-N |
| XLogP | 4.51 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|