C24H22N6OS — CID 171089215
N-[7-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-cyclopent-3-en-1-yloxyquinazolin-4-yl]-1,3-benzothiazol-6-amine (PubChem CID 171089215) has the molecular formula C24H22N6OS and a molecular weight of 442.55 g/mol. Its IUPAC name is N-[7-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-cyclopent-3-en-1-yloxyquinazolin-4-yl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[7-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-cyclopent-3-en-1-yloxyquinazolin-4-yl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 171089215 |
| Molecular Formula | C24H22N6OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[7-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-5-cyclopent-3-en-1-yloxyquinazolin-4-yl]-1,3-benzothiazol-6-amine |
| SMILES | C/N=C/C(=C\N)c1cc(OC2CC=CC2)c2c(Nc3ccc4ncsc4c3)ncnc2c1 |
| InChI | InChI=1S/C24H22N6OS/c1-26-12-16(11-25)15-8-20-23(21(9-15)31-18-4-2-3-5-18)24(28-13-27-20)30-17-6-7-19-22(10-17)32-14-29-19/h2-3,6-14,18H,4-5,25H2,1H3,(H,27,28,30)/b16-11+,26-12+ |
| InChIKey | BXURLAHCVHOGLM-YPTLSZHJSA-N |
| XLogP | 5.08 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|