C26H29N7O2S — CID 171089532
7-[(E)-1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl]-4-(1,3-benzothiazol-6-ylamino)quinazolin-5-ol;1-methyl-3,4-dihydro-2H-pyridine (PubChem CID 171089532) has the molecular formula C26H29N7O2S and a molecular weight of 503.63 g/mol. Its IUPAC name is 7-[(E)-1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl]-4-(1,3-benzothiazol-6-ylamino)quinazolin-5-ol;1-methyl-3,4-dihydro-2H-pyridine.
| Compound Name | 7-[(E)-1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl]-4-(1,3-benzothiazol-6-ylamino)quinazolin-5-ol;1-methyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 171089532 |
| Molecular Formula | C26H29N7O2S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 7-[(E)-1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl]-4-(1,3-benzothiazol-6-ylamino)quinazolin-5-ol;1-methyl-3,4-dihydro-2H-pyridine |
| SMILES | C/N=C/C(=C(\N)OC)c1cc(O)c2c(Nc3ccc4ncsc4c3)ncnc2c1.CN1C=CCCC1 |
| InChI | InChI=1S/C20H18N6O2S.C6H11N/c1-22-8-13(19(21)28-2)11-5-15-18(16(27)6-11)20(24-9-23-15)26-12-3-4-14-17(7-12)29-10-25-14;1-7-5-3-2-4-6-7/h3-10,27H,21H2,1-2H3,(H,23,24,26);3,5H,2,4,6H2,1H3/b19-13-,22-8+; |
| InChIKey | JUENUMHGHXKFIO-ZKSJUVJPSA-N |
| XLogP | 4.89 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|