C24H25N6O4S+ — CID 171089360
[(Z)-2-[4-(1,3-benzothiazol-6-ylamino)-5-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyquinazolin-7-yl]-3-imino-3-methoxyprop-1-enyl]-methylazanium (PubChem CID 171089360) has the molecular formula C24H25N6O4S+ and a molecular weight of 493.57 g/mol. Its IUPAC name is [(Z)-2-[4-(1,3-benzothiazol-6-ylamino)-5-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyquinazolin-7-yl]-3-imino-3-methoxyprop-1-enyl]-methylazanium.
| Compound Name | [(Z)-2-[4-(1,3-benzothiazol-6-ylamino)-5-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyquinazolin-7-yl]-3-imino-3-methoxyprop-1-enyl]-methylazanium |
|---|---|
| PubChem CID | 171089360 |
| Molecular Formula | C24H25N6O4S+ |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | [(Z)-2-[4-(1,3-benzothiazol-6-ylamino)-5-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyquinazolin-7-yl]-3-imino-3-methoxyprop-1-enyl]-methylazanium |
| SMILES | [H]/N=C(OC)/C(=C\[NH2+]C)c1cc(O[C@H]2COC[C@@H]2O)c2c(Nc3ccc4ncsc4c3)ncnc2c1 |
| InChI | InChI=1S/C24H24N6O4S/c1-26-8-15(23(25)32-2)13-5-17-22(19(6-13)34-20-10-33-9-18(20)31)24(28-11-27-17)30-14-3-4-16-21(7-14)35-12-29-16/h3-8,11-12,18,20,25-26,31H,9-10H2,1-2H3,(H,27,28,30)/p+1/b15-8-,25-23-/t18-,20-/m0/s1 |
| InChIKey | ACHLCCJOUAVLMP-WJTMLMRHSA-O |
| XLogP | 2.28 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|