C12H13NS — CID 171090119
5-cyclopropyl-2-ethylthieno[2,3-b]pyridine (PubChem CID 171090119) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is 5-cyclopropyl-2-ethylthieno[2,3-b]pyridine.
| Compound Name | 5-cyclopropyl-2-ethylthieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 171090119 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 5-cyclopropyl-2-ethylthieno[2,3-b]pyridine |
| SMILES | CCc1cc2cc(C3CC3)cnc2s1 |
| InChI | InChI=1S/C12H13NS/c1-2-11-6-9-5-10(8-3-4-8)7-13-12(9)14-11/h5-8H,2-4H2,1H3 |
| InChIKey | CLWFDNVAKOLPFB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |