C17H20N6 — CID 171090311
4-N-[[4-(1-pyrazol-1-ylpropyl)phenyl]methyl]pyrimidine-4,6-diamine (PubChem CID 171090311) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-N-[[4-(1-pyrazol-1-ylpropyl)phenyl]methyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[[4-(1-pyrazol-1-ylpropyl)phenyl]methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 171090311 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-N-[[4-(1-pyrazol-1-ylpropyl)phenyl]methyl]pyrimidine-4,6-diamine |
| SMILES | CCC(c1ccc(CNc2cc(N)ncn2)cc1)n1cccn1 |
| InChI | InChI=1S/C17H20N6/c1-2-15(23-9-3-8-22-23)14-6-4-13(5-7-14)11-19-17-10-16(18)20-12-21-17/h3-10,12,15H,2,11H2,1H3,(H3,18,19,20,21) |
| InChIKey | HAAAJJVNZJTFSA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |