C22H33F4N5O4 — CID 171091707
ethane;methyl (1Z)-3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)piperidine-1-carbohydrazonate (PubChem CID 171091707) has the molecular formula C22H33F4N5O4 and a molecular weight of 507.53 g/mol. Its IUPAC name is ethane;methyl (1Z)-3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)piperidine-1-carbohydrazonate.
| Compound Name | ethane;methyl (1Z)-3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)piperidine-1-carbohydrazonate |
|---|---|
| PubChem CID | 171091707 |
| Molecular Formula | C22H33F4N5O4 |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | ethane;methyl (1Z)-3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)piperidine-1-carbohydrazonate |
| SMILES | CC.CO/C(=N\N)N1CC(CO)CC(N(C(=O)NCc2ccc(OC(F)(F)F)cc2F)C2CC2)C1 |
| InChI | InChI=1S/C20H27F4N5O4.C2H6/c1-32-19(27-25)28-9-12(11-30)6-15(10-28)29(14-3-4-14)18(31)26-8-13-2-5-16(7-17(13)21)33-20(22,23)24;1-2/h2,5,7,12,14-15,30H,3-4,6,8-11,25H2,1H3,(H,26,31);1-2H3/b27-19-; |
| InChIKey | DEPJCMMDJRNTAZ-MORRFHCESA-N |
| XLogP | 2.98 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|