C20H27F4N5O4 — CID 171091769
amino 3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)-N-methylpiperidine-1-carboximidate (PubChem CID 171091769) has the molecular formula C20H27F4N5O4 and a molecular weight of 477.46 g/mol. Its IUPAC name is amino 3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)-N-methylpiperidine-1-carboximidate.
| Compound Name | amino 3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)-N-methylpiperidine-1-carboximidate |
|---|---|
| PubChem CID | 171091769 |
| Molecular Formula | C20H27F4N5O4 |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | amino 3-[cyclopropyl-[[2-fluoro-4-(trifluoromethoxy)phenyl]methylcarbamoyl]amino]-5-(hydroxymethyl)-N-methylpiperidine-1-carboximidate |
| SMILES | C/N=C(\ON)N1CC(CO)CC(N(C(=O)NCc2ccc(OC(F)(F)F)cc2F)C2CC2)C1 |
| InChI | InChI=1S/C20H27F4N5O4/c1-26-19(33-25)28-9-12(11-30)6-15(10-28)29(14-3-4-14)18(31)27-8-13-2-5-16(7-17(13)21)32-20(22,23)24/h2,5,7,12,14-15,30H,3-4,6,8-11,25H2,1H3,(H,27,31)/b26-19- |
| InChIKey | VUSFHRKUWKSGLT-XHPQRKPJSA-N |
| XLogP | 1.96 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|