C6H5BN2O2 — CID 171092005
CID 171092005 (PubChem CID 171092005) has the molecular formula C6H5BN2O2 and a molecular weight of 147.93 g/mol.
| Compound Name | CID 171092005 |
|---|---|
| PubChem CID | 171092005 |
| Molecular Formula | C6H5BN2O2 |
| Molecular Weight | 147.93 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | — |
| SMILES | [B]NC(=O)c1cc(=O)cc[nH]1 |
| InChI | InChI=1S/C6H5BN2O2/c7-9-6(11)5-3-4(10)1-2-8-5/h1-3H,(H,8,10)(H,9,11) |
| InChIKey | PPVQVDWBUJECCY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.93 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|