C14H20N2O3 — CID 164629335
N-[(1S,2S)-2-ethoxycyclohexyl]-4-oxo-1H-pyridine-2-carboxamide (PubChem CID 164629335) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[(1S,2S)-2-ethoxycyclohexyl]-4-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-ethoxycyclohexyl]-4-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164629335 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[(1S,2S)-2-ethoxycyclohexyl]-4-oxo-1H-pyridine-2-carboxamide |
| SMILES | CCO[C@H]1CCCC[C@@H]1NC(=O)c1cc(=O)cc[nH]1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-19-13-6-4-3-5-11(13)16-14(18)12-9-10(17)7-8-15-12/h7-9,11,13H,2-6H2,1H3,(H,15,17)(H,16,18)/t11-,13-/m0/s1 |
| InChIKey | ZDFIQMFAFCYWAE-AAEUAGOBSA-N |
| XLogP | 1.45 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |