C20H45BN4O4S — CID 171092765
CID 171092765 (PubChem CID 171092765) has the molecular formula C20H45BN4O4S and a molecular weight of 448.48 g/mol.
| Compound Name | CID 171092765 |
|---|---|
| PubChem CID | 171092765 |
| Molecular Formula | C20H45BN4O4S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | — |
| SMILES | CC.CC.CC.CCCCCCSCNC(=O)CNC(=O)CNC(=O)CN.[B]C=O |
| InChI | InChI=1S/C13H26N4O3S.3C2H6.CHBO/c1-2-3-4-5-6-21-10-17-13(20)9-16-12(19)8-15-11(18)7-14;3*1-2;2-1-3/h2-10,14H2,1H3,(H,15,18)(H,16,19)(H,17,20);3*1-2H3;1H |
| InChIKey | LKRGUBLEHNDZDP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|