C21H38N2O2 — CID 144912619
2-amino-N-[(3E,12Z)-2-oxononadeca-3,12-dienyl]acetamide (PubChem CID 144912619) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2-amino-N-[(3E,12Z)-2-oxononadeca-3,12-dienyl]acetamide.
| Compound Name | 2-amino-N-[(3E,12Z)-2-oxononadeca-3,12-dienyl]acetamide |
|---|---|
| PubChem CID | 144912619 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 2-amino-N-[(3E,12Z)-2-oxononadeca-3,12-dienyl]acetamide |
| SMILES | CCCCCC/C=C\CCCCCCC/C=C/C(=O)CNC(=O)CN |
| InChI | InChI=1S/C21H38N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)19-23-21(25)18-22/h7-8,16-17H,2-6,9-15,18-19,22H2,1H3,(H,23,25)/b8-7-,17-16+ |
| InChIKey | WLDLUQZJWDTLGA-MDTHSCKASA-N |
| XLogP | 4.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|