About copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione
copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione (PubChem CID 174907520) has the molecular formula C23H45CuNO2
and a molecular weight of 431.16 g/mol. Its IUPAC name is copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione.
Molecular Properties
| Compound Name | copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione |
| PubChem CID | 174907520 |
| Molecular Formula | C23H45CuNO2 |
| Molecular Weight | 431.16 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.CCCCCCCC/C=C\CCCCCCCCN.[Cu] |
| InChI | InChI=1S/C18H37N.C5H8O2.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(6)3-5(2)7;/h9-10H,2-8,11-19H2,1H3;3H2,1-2H3;/b10-9-;; |
| InChIKey | ZHGFCTKCWSPYDY-XXAVUKJNSA-N |
| XLogP | 6.53 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.16 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione?
The IUPAC name of copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione (CID 174907520) is copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione.
What is the SMILES notation for copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione?
The canonical SMILES for copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione is CC(=O)CC(C)=O.CCCCCCCC/C=C\CCCCCCCCN.[Cu].
What is the InChIKey of copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione?
The InChIKey is ZHGFCTKCWSPYDY-XXAVUKJNSA-N. The full InChI is InChI=1S/C18H37N.C5H8O2.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(6)3-5(2)7;/h9-10H,2-8,11-19H2,1H3;3H2,1-2H3;/b10-9-;;.
What are the key properties of copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione?
copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione has a molecular weight of 431.16 g/mol, XLogP of 6.53, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(Z)-octadec-9-en-1-amine;pentane-2,4-dione is sourced from PubChem (CID 174907520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).