C14H14F3N — CID 171092981
3-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidine (PubChem CID 171092981) has the molecular formula C14H14F3N and a molecular weight of 253.27 g/mol. Its IUPAC name is 3-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidine.
| Compound Name | 3-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidine |
|---|---|
| PubChem CID | 171092981 |
| Molecular Formula | C14H14F3N |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolidine |
| SMILES | CC1(C#Cc2ccc(C(F)(F)F)cc2)CCNC1 |
| InChI | InChI=1S/C14H14F3N/c1-13(8-9-18-10-13)7-6-11-2-4-12(5-3-11)14(15,16)17/h2-5,18H,8-10H2,1H3 |
| InChIKey | VNBSXBMHYJPSTI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|