C13H11F3O — CID 163274338
1-[2-[4-(trifluoromethyl)phenyl]ethynyl]cyclobutan-1-ol (PubChem CID 163274338) has the molecular formula C13H11F3O and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-[2-[4-(trifluoromethyl)phenyl]ethynyl]cyclobutan-1-ol.
| Compound Name | 1-[2-[4-(trifluoromethyl)phenyl]ethynyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 163274338 |
| Molecular Formula | C13H11F3O |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-[2-[4-(trifluoromethyl)phenyl]ethynyl]cyclobutan-1-ol |
| SMILES | OC1(C#Cc2ccc(C(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C13H11F3O/c14-13(15,16)11-4-2-10(3-5-11)6-9-12(17)7-1-8-12/h2-5,17H,1,7-8H2 |
| InChIKey | ODUOLZZLECFUIY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|