C23H34N5O3+ — CID 171094988
tert-butyl (3Z,4Z)-3-[(E)-1-cyano-2-(dimethylaminomethylideneamino)but-2-enylidene]-4-propylidene-1,6,7,9-tetrahydropyrazino[2,1-c][1,4]oxazin-5-ium-8-carboxylate (PubChem CID 171094988) has the molecular formula C23H34N5O3+ and a molecular weight of 428.56 g/mol. Its IUPAC name is tert-butyl (3Z,4Z)-3-[(E)-1-cyano-2-(dimethylaminomethylideneamino)but-2-enylidene]-4-propylidene-1,6,7,9-tetrahydropyrazino[2,1-c][1,4]oxazin-5-ium-8-carboxylate.
| Compound Name | tert-butyl (3Z,4Z)-3-[(E)-1-cyano-2-(dimethylaminomethylideneamino)but-2-enylidene]-4-propylidene-1,6,7,9-tetrahydropyrazino[2,1-c][1,4]oxazin-5-ium-8-carboxylate |
|---|---|
| PubChem CID | 171094988 |
| Molecular Formula | C23H34N5O3+ |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl (3Z,4Z)-3-[(E)-1-cyano-2-(dimethylaminomethylideneamino)but-2-enylidene]-4-propylidene-1,6,7,9-tetrahydropyrazino[2,1-c][1,4]oxazin-5-ium-8-carboxylate |
| SMILES | C/C=C(/N=C/N(C)C)C(\C#N)=C1\OCC2=[N+](CCN(C(=O)OC(C)(C)C)C2)\C1=C/CC |
| InChI | InChI=1S/C23H34N5O3/c1-8-10-20-21(18(13-24)19(9-2)25-16-26(6)7)30-15-17-14-27(11-12-28(17)20)22(29)31-23(3,4)5/h9-10,16H,8,11-12,14-15H2,1-7H3/q+1/b19-9+,20-10-,21-18+,25-16+ |
| InChIKey | AIKZDFZHYSCVHT-IZNAHDABSA-N |
| XLogP | 3.29 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|