C12H14ClN — CID 171097079
N-[(2-chlorophenyl)methyl]-1-cyclopropylethenamine (PubChem CID 171097079) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-cyclopropylethenamine.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-cyclopropylethenamine |
|---|---|
| PubChem CID | 171097079 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-cyclopropylethenamine |
| SMILES | C=C(NCc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C12H14ClN/c1-9(10-6-7-10)14-8-11-4-2-3-5-12(11)13/h2-5,10,14H,1,6-8H2 |
| InChIKey | RSYSCAABIFREFH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |