C17H10FN3O2 — CID 171098944
7-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,7-naphthyridin-8-one (PubChem CID 171098944) has the molecular formula C17H10FN3O2 and a molecular weight of 307.28 g/mol. Its IUPAC name is 7-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,7-naphthyridin-8-one.
| Compound Name | 7-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 171098944 |
| Molecular Formula | C17H10FN3O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 7-[5-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,7-naphthyridin-8-one |
| SMILES | O=c1c2ncccc2ccn1-c1ncoc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H10FN3O2/c18-13-5-3-12(4-6-13)15-16(20-10-23-15)21-9-7-11-2-1-8-19-14(11)17(21)22/h1-10H |
| InChIKey | RBQUIWDDVMCHGN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |