C23H25F3N8O3 — CID 171100058
1-[2-[3-[(3aR,6aR)-1-(5-cyano-2-pyridinyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-5-methanimidoyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 171100058) has the molecular formula C23H25F3N8O3 and a molecular weight of 518.50 g/mol. Its IUPAC name is 1-[2-[3-[(3aR,6aR)-1-(5-cyano-2-pyridinyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-5-methanimidoyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-[2-[3-[(3aR,6aR)-1-(5-cyano-2-pyridinyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-5-methanimidoyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171100058 |
| Molecular Formula | C23H25F3N8O3 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 1-[2-[3-[(3aR,6aR)-1-(5-cyano-2-pyridinyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-5-methanimidoyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | [H]/N=C/c1c(C(N)=O)c(C(F)(F)F)nn1CCOCCC(=O)N1CC[C@@H]2[C@H]1CCN2c1ccc(C#N)cn1 |
| InChI | InChI=1S/C23H25F3N8O3/c24-23(25,26)21-20(22(29)36)17(12-28)34(31-21)8-10-37-9-5-19(35)33-7-4-15-16(33)3-6-32(15)18-2-1-14(11-27)13-30-18/h1-2,12-13,15-16,28H,3-10H2,(H2,29,36)/b28-12+/t15-,16-/m1/s1 |
| InChIKey | XNVYWPNFPMGEFA-HANCKVSVSA-N |
| XLogP | 1.55 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|