C22H22F6N8O3 — CID 171100003
1-[2-[3-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrazin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-3-(trifluoromethyl)-5H-pyrazolo[3,4-d]pyridazin-4-one (PubChem CID 171100003) has the molecular formula C22H22F6N8O3 and a molecular weight of 560.46 g/mol. Its IUPAC name is 1-[2-[3-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrazin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-3-(trifluoromethyl)-5H-pyrazolo[3,4-d]pyridazin-4-one.
| Compound Name | 1-[2-[3-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrazin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-3-(trifluoromethyl)-5H-pyrazolo[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 171100003 |
| Molecular Formula | C22H22F6N8O3 |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 1-[2-[3-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrazin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]ethyl]-3-(trifluoromethyl)-5H-pyrazolo[3,4-d]pyridazin-4-one |
| SMILES | O=C(CCOCCn1nc(C(F)(F)F)c2c(=O)[nH]ncc21)N1CC[C@@H]2[C@H]1CCN2c1cnc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H22F6N8O3/c23-21(24,25)15-10-30-16(11-29-15)34-4-1-13-12(34)2-5-35(13)17(37)3-7-39-8-6-36-14-9-31-32-20(38)18(14)19(33-36)22(26,27)28/h9-13H,1-8H2,(H,32,38)/t12-,13-/m1/s1 |
| InChIKey | ZSOGYVYFDOGZAP-CHWSQXEVSA-N |
| XLogP | 2.23 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|