C22H25F6N7O3 — CID 146219210
4-[1-[3-[(3aS,6aS)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 146219210) has the molecular formula C22H25F6N7O3 and a molecular weight of 549.48 g/mol. Its IUPAC name is 4-[1-[3-[(3aS,6aS)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[1-[3-[(3aS,6aS)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 146219210 |
| Molecular Formula | C22H25F6N7O3 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 4-[1-[3-[(3aS,6aS)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | CC(COCCC(=O)N1CC[C@H]2[C@@H]1CCN2c1ncc(C(F)(F)F)cn1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C22H25F6N7O3/c1-12(32-14-10-31-33-19(37)18(14)22(26,27)28)11-38-7-4-17(36)34-5-2-16-15(34)3-6-35(16)20-29-8-13(9-30-20)21(23,24)25/h8-10,12,15-16H,2-7,11H2,1H3,(H2,32,33,37)/t12?,15-,16-/m0/s1 |
| InChIKey | LMSVLCWFUNWCEE-KZMQIFKDSA-N |
| XLogP | 2.68 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|