C18H20ClN7O2 — CID 171100700
3-[6-[[(1S,3S)-3-[(5-chloropyrazin-2-yl)amino]cyclopentyl]amino]-3-pyridinyl]-1-methylimidazolidine-2,4-dione (PubChem CID 171100700) has the molecular formula C18H20ClN7O2 and a molecular weight of 401.86 g/mol. Its IUPAC name is 3-[6-[[(1S,3S)-3-[(5-chloropyrazin-2-yl)amino]cyclopentyl]amino]-3-pyridinyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[6-[[(1S,3S)-3-[(5-chloropyrazin-2-yl)amino]cyclopentyl]amino]-3-pyridinyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 171100700 |
| Molecular Formula | C18H20ClN7O2 |
| Molecular Weight | 401.86 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[6-[[(1S,3S)-3-[(5-chloropyrazin-2-yl)amino]cyclopentyl]amino]-3-pyridinyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(c2ccc(N[C@H]3CC[C@H](Nc4cnc(Cl)cn4)C3)nc2)C1=O |
| InChI | InChI=1S/C18H20ClN7O2/c1-25-10-17(27)26(18(25)28)13-4-5-15(21-7-13)23-11-2-3-12(6-11)24-16-9-20-14(19)8-22-16/h4-5,7-9,11-12H,2-3,6,10H2,1H3,(H,21,23)(H,22,24)/t11-,12-/m0/s1 |
| InChIKey | OQWYZZXTHAKZOL-RYUDHWBXSA-N |
| XLogP | 2.37 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.86 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|