C11H17N3O — CID 171101140
3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-1H-pyridin-2-one;ethane (PubChem CID 171101140) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-1H-pyridin-2-one;ethane.
| Compound Name | 3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-1H-pyridin-2-one;ethane |
|---|---|
| PubChem CID | 171101140 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-1H-pyridin-2-one;ethane |
| SMILES | C/N=C/C(=C\N)c1ccc[nH]c1=O.CC |
| InChI | InChI=1S/C9H11N3O.C2H6/c1-11-6-7(5-10)8-3-2-4-12-9(8)13;1-2/h2-6H,10H2,1H3,(H,12,13);1-2H3/b7-5+,11-6+; |
| InChIKey | ZREWBDPYLSTJQF-WBNCZDIRSA-N |
| XLogP | 1.40 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|