About cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine
cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine (PubChem CID 171101243) has the molecular formula C9H19N5
and a molecular weight of 197.29 g/mol. Its IUPAC name is cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine.
Molecular Properties
| Compound Name | cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine |
| PubChem CID | 171101243 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine |
| SMILES | NC1CCCC1.[H]/N=C(C)/C=N\C(N)=N\[H] |
| InChI | InChI=1S/C5H11N.C4H8N4/c6-5-3-1-2-4-5;1-3(5)2-8-4(6)7/h5H,1-4,6H2;2,5H,1H3,(H3,6,7)/b;5-3+,8-2- |
| InChIKey | KFPYSRPWEXMJCB-RDQMYXQQSA-N |
| XLogP | 0.88 |
| TPSA | 112.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine?
The IUPAC name of cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine (CID 171101243) is cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine.
What is the SMILES notation for cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine?
The canonical SMILES for cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine is NC1CCCC1.[H]/N=C(C)/C=N\C(N)=N\[H].
What is the InChIKey of cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine?
The InChIKey is KFPYSRPWEXMJCB-RDQMYXQQSA-N. The full InChI is InChI=1S/C5H11N.C4H8N4/c6-5-3-1-2-4-5;1-3(5)2-8-4(6)7/h5H,1-4,6H2;2,5H,1H3,(H3,6,7)/b;5-3+,8-2-.
What are the key properties of cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine?
cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine has a molecular weight of 197.29 g/mol, XLogP of 0.88, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanamine;(1Z)-1-(2-iminopropylidene)guanidine is sourced from PubChem (CID 171101243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).