C20H25BrN4O2 — CID 171101722
tert-butyl 7-[4-(4-bromoimidazol-1-yl)phenyl]-1,7-diazaspiro[3.4]octane-1-carboxylate (PubChem CID 171101722) has the molecular formula C20H25BrN4O2 and a molecular weight of 433.35 g/mol. Its IUPAC name is tert-butyl 7-[4-(4-bromoimidazol-1-yl)phenyl]-1,7-diazaspiro[3.4]octane-1-carboxylate.
| Compound Name | tert-butyl 7-[4-(4-bromoimidazol-1-yl)phenyl]-1,7-diazaspiro[3.4]octane-1-carboxylate |
|---|---|
| PubChem CID | 171101722 |
| Molecular Formula | C20H25BrN4O2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | tert-butyl 7-[4-(4-bromoimidazol-1-yl)phenyl]-1,7-diazaspiro[3.4]octane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCN(c1ccc(-n3cnc(Br)c3)cc1)C2 |
| InChI | InChI=1S/C20H25BrN4O2/c1-19(2,3)27-18(26)25-11-9-20(25)8-10-23(13-20)15-4-6-16(7-5-15)24-12-17(21)22-14-24/h4-7,12,14H,8-11,13H2,1-3H3 |
| InChIKey | PNNPZWNENGFJPR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|