C25H33F3N6O — CID 171102564
7-(cyclobutylmethyl)-3-[2-[(6,6-dimethylpiperidin-3-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one (PubChem CID 171102564) has the molecular formula C25H33F3N6O and a molecular weight of 490.57 g/mol. Its IUPAC name is 7-(cyclobutylmethyl)-3-[2-[(6,6-dimethylpiperidin-3-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one.
| Compound Name | 7-(cyclobutylmethyl)-3-[2-[(6,6-dimethylpiperidin-3-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one |
|---|---|
| PubChem CID | 171102564 |
| Molecular Formula | C25H33F3N6O |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 7-(cyclobutylmethyl)-3-[2-[(6,6-dimethylpiperidin-3-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one |
| SMILES | CC1(C)CCC(Nc2ncc(C(F)(F)F)c(-c3c[nH]c4c3CCCN(CC3CCC3)C4=O)n2)CN1 |
| InChI | InChI=1S/C25H33F3N6O/c1-24(2)9-8-16(11-31-24)32-23-30-13-19(25(26,27)28)20(33-23)18-12-29-21-17(18)7-4-10-34(22(21)35)14-15-5-3-6-15/h12-13,15-16,29,31H,3-11,14H2,1-2H3,(H,30,32,33) |
| InChIKey | FVCWMMHKMDXJJV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |