C24H31F3N6O — CID 171102605
(6S)-7-cyclopropyl-3-[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6-methyl-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one (PubChem CID 171102605) has the molecular formula C24H31F3N6O and a molecular weight of 476.55 g/mol. Its IUPAC name is (6S)-7-cyclopropyl-3-[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6-methyl-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one.
| Compound Name | (6S)-7-cyclopropyl-3-[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6-methyl-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one |
|---|---|
| PubChem CID | 171102605 |
| Molecular Formula | C24H31F3N6O |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (6S)-7-cyclopropyl-3-[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6-methyl-1,4,5,6-tetrahydropyrrolo[2,3-c]azepin-8-one |
| SMILES | C[C@H]1CCc2c(-c3nc(N[C@H]4CCC(C)(C)NC4)ncc3C(F)(F)F)c[nH]c2C(=O)N1C1CC1 |
| InChI | InChI=1S/C24H31F3N6O/c1-13-4-7-16-17(11-28-20(16)21(34)33(13)15-5-6-15)19-18(24(25,26)27)12-29-22(32-19)31-14-8-9-23(2,3)30-10-14/h11-15,28,30H,4-10H2,1-3H3,(H,29,31,32)/t13-,14-/m0/s1 |
| InChIKey | OORFRKFNGIQTHZ-KBPBESRZSA-N |
| XLogP | 4.37 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |