C25H40F2N2 — CID 171102725
(3E)-5,5-difluoro-6-methyl-4-[[(E)-6-[(8S)-spiro[2.7]decan-8-yl]hex-2-en-3-yl]iminomethyl]hepta-3,6-dien-3-amine (PubChem CID 171102725) has the molecular formula C25H40F2N2 and a molecular weight of 406.61 g/mol. Its IUPAC name is (3E)-5,5-difluoro-6-methyl-4-[[(E)-6-[(8S)-spiro[2.7]decan-8-yl]hex-2-en-3-yl]iminomethyl]hepta-3,6-dien-3-amine.
| Compound Name | (3E)-5,5-difluoro-6-methyl-4-[[(E)-6-[(8S)-spiro[2.7]decan-8-yl]hex-2-en-3-yl]iminomethyl]hepta-3,6-dien-3-amine |
|---|---|
| PubChem CID | 171102725 |
| Molecular Formula | C25H40F2N2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | (3E)-5,5-difluoro-6-methyl-4-[[(E)-6-[(8S)-spiro[2.7]decan-8-yl]hex-2-en-3-yl]iminomethyl]hepta-3,6-dien-3-amine |
| SMILES | C=C(C)C(F)(F)C(/C=N/C(=C/C)CCC[C@@H]1CCCCC2(CC1)CC2)=C(/N)CC |
| InChI | InChI=1S/C25H40F2N2/c1-5-21(29-18-22(23(28)6-2)25(26,27)19(3)4)12-9-11-20-10-7-8-14-24(15-13-20)16-17-24/h5,18,20H,3,6-17,28H2,1-2,4H3/b21-5+,23-22+,29-18+/t20-/m0/s1 |
| InChIKey | UABBDPOXXOHVLO-QUJAMDIVSA-N |
| XLogP | 7.72 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|