C18H29F2N — CID 171493188
(2Z,6E)-7-(1,1-difluoroethyl)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocine (PubChem CID 171493188) has the molecular formula C18H29F2N and a molecular weight of 297.43 g/mol. Its IUPAC name is (2Z,6E)-7-(1,1-difluoroethyl)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocine.
| Compound Name | (2Z,6E)-7-(1,1-difluoroethyl)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocine |
|---|---|
| PubChem CID | 171493188 |
| Molecular Formula | C18H29F2N |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | (2Z,6E)-7-(1,1-difluoroethyl)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocine |
| SMILES | CC[C@@H](C)CCCCCC1=C/CC/C=C(C(C)(F)F)/C=N\1 |
| InChI | InChI=1S/C18H29F2N/c1-4-15(2)10-6-5-7-12-17-13-9-8-11-16(14-21-17)18(3,19)20/h11,13-15H,4-10,12H2,1-3H3/b16-11+,17-13-,21-14-/t15-/m1/s1 |
| InChIKey | OFLPNNONBDYNHI-BLCPNKHUSA-N |
| XLogP | 6.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|