C17H28F2NP — CID 171493396
[difluoro-[(2Z,6E)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocin-7-yl]methyl]phosphane (PubChem CID 171493396) has the molecular formula C17H28F2NP and a molecular weight of 315.39 g/mol. Its IUPAC name is [difluoro-[(2Z,6E)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocin-7-yl]methyl]phosphane.
| Compound Name | [difluoro-[(2Z,6E)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocin-7-yl]methyl]phosphane |
|---|---|
| PubChem CID | 171493396 |
| Molecular Formula | C17H28F2NP |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [difluoro-[(2Z,6E)-2-[(6R)-6-methyloctyl]-4,5-dihydroazocin-7-yl]methyl]phosphane |
| SMILES | CC[C@@H](C)CCCCCC1=C/CC/C=C(C(F)(F)P)/C=N\1 |
| InChI | InChI=1S/C17H28F2NP/c1-3-14(2)9-5-4-6-11-16-12-8-7-10-15(13-20-16)17(18,19)21/h10,12-14H,3-9,11,21H2,1-2H3/b15-10+,16-12-,20-13-/t14-/m1/s1 |
| InChIKey | FQODXQJZIGKHEW-LSBLWAFDSA-N |
| XLogP | 6.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|