C14H15BrN4 — CID 171104227
N-[1-(4-bromo-1-pyridin-2-ylpyrazol-5-yl)ethyl]-1-cyclopropylmethanimine (PubChem CID 171104227) has the molecular formula C14H15BrN4 and a molecular weight of 319.21 g/mol. Its IUPAC name is N-[1-(4-bromo-1-pyridin-2-ylpyrazol-5-yl)ethyl]-1-cyclopropylmethanimine.
| Compound Name | N-[1-(4-bromo-1-pyridin-2-ylpyrazol-5-yl)ethyl]-1-cyclopropylmethanimine |
|---|---|
| PubChem CID | 171104227 |
| Molecular Formula | C14H15BrN4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[1-(4-bromo-1-pyridin-2-ylpyrazol-5-yl)ethyl]-1-cyclopropylmethanimine |
| SMILES | CC(/N=C/C1CC1)c1c(Br)cnn1-c1ccccn1 |
| InChI | InChI=1S/C14H15BrN4/c1-10(17-8-11-5-6-11)14-12(15)9-18-19(14)13-4-2-3-7-16-13/h2-4,7-11H,5-6H2,1H3/b17-8+ |
| InChIKey | MOGBQGPIDHBVOY-CAOOACKPSA-N |
| XLogP | 3.57 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|